C11H13Cl2NS — CID 83928346
3-(2,4-dichlorophenyl)-2-methylbutanethioamide (PubChem CID 83928346) has the molecular formula C11H13Cl2NS and a molecular weight of 262.21 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-methylbutanethioamide.
| Compound Name | 3-(2,4-dichlorophenyl)-2-methylbutanethioamide |
|---|---|
| PubChem CID | 83928346 |
| Molecular Formula | C11H13Cl2NS |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-methylbutanethioamide |
| SMILES | CC(C(N)=S)C(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NS/c1-6(7(2)11(14)15)9-4-3-8(12)5-10(9)13/h3-7H,1-2H3,(H2,14,15) |
| InChIKey | FYQJENQNLOSGNG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|