C8H9Cl2N — CID 2496562
(1S)-1-(2,4-dichlorophenyl)ethanamine (PubChem CID 2496562) has the molecular formula C8H9Cl2N and a molecular weight of 190.07 g/mol. Its IUPAC name is (1S)-1-(2,4-dichlorophenyl)ethanamine.
| Compound Name | (1S)-1-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 2496562 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | (1S)-1-(2,4-dichlorophenyl)ethanamine |
| SMILES | C[C@H](N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl2N/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5H,11H2,1H3/t5-/m0/s1 |
| InChIKey | OUVZHZAOWDHBOU-YFKPBYRVSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |