C16H15Cl2NO — CID 22483399
N-[1-(2,3-dichlorophenyl)ethyl]-1-(2-methoxyphenyl)methanimine (PubChem CID 22483399) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is N-[1-(2,3-dichlorophenyl)ethyl]-1-(2-methoxyphenyl)methanimine.
| Compound Name | N-[1-(2,3-dichlorophenyl)ethyl]-1-(2-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 22483399 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-[1-(2,3-dichlorophenyl)ethyl]-1-(2-methoxyphenyl)methanimine |
| SMILES | COc1ccccc1/C=N/C(C)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl2NO/c1-11(13-7-5-8-14(17)16(13)18)19-10-12-6-3-4-9-15(12)20-2/h3-11H,1-2H3/b19-10+ |
| InChIKey | PJBRTANVOCHMNE-VXLYETTFSA-N |
| XLogP | 5.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|