C17H16Cl3NO2 — CID 22483253
1-(3,4-dimethoxyphenyl)-N-[1-(2,3,4-trichlorophenyl)ethyl]methanimine (PubChem CID 22483253) has the molecular formula C17H16Cl3NO2 and a molecular weight of 372.68 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[1-(2,3,4-trichlorophenyl)ethyl]methanimine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[1-(2,3,4-trichlorophenyl)ethyl]methanimine |
|---|---|
| PubChem CID | 22483253 |
| Molecular Formula | C17H16Cl3NO2 |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[1-(2,3,4-trichlorophenyl)ethyl]methanimine |
| SMILES | COc1ccc(/C=N/C(C)c2ccc(Cl)c(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C17H16Cl3NO2/c1-10(12-5-6-13(18)17(20)16(12)19)21-9-11-4-7-14(22-2)15(8-11)23-3/h4-10H,1-3H3/b21-9+ |
| InChIKey | USVXNWVRAYYKGC-ZVBGSRNCSA-N |
| XLogP | 5.84 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|