About 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene
1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene (PubChem CID 158048784) has the molecular formula C20H29Cl
and a molecular weight of 304.90 g/mol. Its IUPAC name is 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene |
| PubChem CID | 158048784 |
| Molecular Formula | C20H29Cl |
| Molecular Weight | 304.90 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene |
| SMILES | C.CC(C)c1ccccc1Cl.Cc1ccccc1C(C)C |
| InChI | InChI=1S/C10H14.C9H11Cl.CH4/c1-8(2)10-7-5-4-6-9(10)3;1-7(2)8-5-3-4-6-9(8)10;/h4-8H,1-3H3;3-7H,1-2H3;1H4 |
| InChIKey | FJFQBUNLCYQUJY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.90 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene?
The IUPAC name of 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene (CID 158048784) is 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene.
What is the SMILES notation for 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene?
The canonical SMILES for 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene is C.CC(C)c1ccccc1Cl.Cc1ccccc1C(C)C.
What is the InChIKey of 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene?
The InChIKey is FJFQBUNLCYQUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C9H11Cl.CH4/c1-8(2)10-7-5-4-6-9(10)3;1-7(2)8-5-3-4-6-9(8)10;/h4-8H,1-3H3;3-7H,1-2H3;1H4.
What are the key properties of 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene?
1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene has a molecular weight of 304.90 g/mol, XLogP of 7.22, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-propan-2-ylbenzene;methane;1-methyl-2-propan-2-ylbenzene is sourced from PubChem (CID 158048784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).