About 2-chlorophenol;2-propan-2-ylphenol
2-chlorophenol;2-propan-2-ylphenol (PubChem CID 67592486) has the molecular formula C15H17ClO2
and a molecular weight of 264.75 g/mol. Its IUPAC name is 2-chlorophenol;2-propan-2-ylphenol.
Molecular Properties
| Compound Name | 2-chlorophenol;2-propan-2-ylphenol |
| PubChem CID | 67592486 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-chlorophenol;2-propan-2-ylphenol |
| SMILES | CC(C)c1ccccc1O.Oc1ccccc1Cl |
| InChI | InChI=1S/C9H12O.C6H5ClO/c1-7(2)8-5-3-4-6-9(8)10;7-5-3-1-2-4-6(5)8/h3-7,10H,1-2H3;1-4,8H |
| InChIKey | GTXILCIWPFXUHP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chlorophenol;2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorophenol;2-propan-2-ylphenol?
The IUPAC name of 2-chlorophenol;2-propan-2-ylphenol (CID 67592486) is 2-chlorophenol;2-propan-2-ylphenol.
What is the SMILES notation for 2-chlorophenol;2-propan-2-ylphenol?
The canonical SMILES for 2-chlorophenol;2-propan-2-ylphenol is CC(C)c1ccccc1O.Oc1ccccc1Cl.
What is the InChIKey of 2-chlorophenol;2-propan-2-ylphenol?
The InChIKey is GTXILCIWPFXUHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C6H5ClO/c1-7(2)8-5-3-4-6-9(8)10;7-5-3-1-2-4-6(5)8/h3-7,10H,1-2H3;1-4,8H.
What are the key properties of 2-chlorophenol;2-propan-2-ylphenol?
2-chlorophenol;2-propan-2-ylphenol has a molecular weight of 264.75 g/mol, XLogP of 4.56, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorophenol;2-propan-2-ylphenol is sourced from PubChem (CID 67592486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).