About methane;phenol;bis(2-propan-2-ylphenol)
methane;phenol;bis(2-propan-2-ylphenol) (PubChem CID 162153244) has the molecular formula C37H46O5
and a molecular weight of 570.77 g/mol. Its IUPAC name is methane;phenol;bis(2-propan-2-ylphenol).
Molecular Properties
| Compound Name | methane;phenol;bis(2-propan-2-ylphenol) |
| PubChem CID | 162153244 |
| Molecular Formula | C37H46O5 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | methane;phenol;bis(2-propan-2-ylphenol) |
| SMILES | C.CC(C)c1ccccc1O.CC(C)c1ccccc1O.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/2C9H12O.3C6H6O.CH4/c2*1-7(2)8-5-3-4-6-9(8)10;3*7-6-4-2-1-3-5-6;/h2*3-7,10H,1-2H3;3*1-5,7H;1H4 |
| InChIKey | ZLMKQWWLOTXETQ-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methane;phenol;bis(2-propan-2-ylphenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;phenol;bis(2-propan-2-ylphenol)?
The IUPAC name of methane;phenol;bis(2-propan-2-ylphenol) (CID 162153244) is methane;phenol;bis(2-propan-2-ylphenol).
What is the SMILES notation for methane;phenol;bis(2-propan-2-ylphenol)?
The canonical SMILES for methane;phenol;bis(2-propan-2-ylphenol) is C.CC(C)c1ccccc1O.CC(C)c1ccccc1O.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of methane;phenol;bis(2-propan-2-ylphenol)?
The InChIKey is ZLMKQWWLOTXETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12O.3C6H6O.CH4/c2*1-7(2)8-5-3-4-6-9(8)10;3*7-6-4-2-1-3-5-6;/h2*3-7,10H,1-2H3;3*1-5,7H;1H4.
What are the key properties of methane;phenol;bis(2-propan-2-ylphenol)?
methane;phenol;bis(2-propan-2-ylphenol) has a molecular weight of 570.77 g/mol, XLogP of 9.84, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;phenol;bis(2-propan-2-ylphenol) is sourced from PubChem (CID 162153244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).