About 2-propan-2-ylphenol;prop-2-enylbenzene
2-propan-2-ylphenol;prop-2-enylbenzene (PubChem CID 175237789) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-propan-2-ylphenol;prop-2-enylbenzene.
Molecular Properties
| Compound Name | 2-propan-2-ylphenol;prop-2-enylbenzene |
| PubChem CID | 175237789 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-propan-2-ylphenol;prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1.CC(C)c1ccccc1O |
| InChI | InChI=1S/C9H12O.C9H10/c1-7(2)8-5-3-4-6-9(8)10;1-2-6-9-7-4-3-5-8-9/h3-7,10H,1-2H3;2-5,7-8H,1,6H2 |
| InChIKey | ZNIXYYNHFKTFRA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylphenol;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylphenol;prop-2-enylbenzene?
The IUPAC name of 2-propan-2-ylphenol;prop-2-enylbenzene (CID 175237789) is 2-propan-2-ylphenol;prop-2-enylbenzene.
What is the SMILES notation for 2-propan-2-ylphenol;prop-2-enylbenzene?
The canonical SMILES for 2-propan-2-ylphenol;prop-2-enylbenzene is C=CCc1ccccc1.CC(C)c1ccccc1O.
What is the InChIKey of 2-propan-2-ylphenol;prop-2-enylbenzene?
The InChIKey is ZNIXYYNHFKTFRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C9H10/c1-7(2)8-5-3-4-6-9(8)10;1-2-6-9-7-4-3-5-8-9/h3-7,10H,1-2H3;2-5,7-8H,1,6H2.
What are the key properties of 2-propan-2-ylphenol;prop-2-enylbenzene?
2-propan-2-ylphenol;prop-2-enylbenzene has a molecular weight of 254.37 g/mol, XLogP of 4.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylphenol;prop-2-enylbenzene is sourced from PubChem (CID 175237789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).