About prop-2-enylbenzene;silicic acid;sulfane
prop-2-enylbenzene;silicic acid;sulfane (PubChem CID 174871791) has the molecular formula C9H16O4SSi
and a molecular weight of 248.38 g/mol. Its IUPAC name is prop-2-enylbenzene;silicic acid;sulfane.
Molecular Properties
| Compound Name | prop-2-enylbenzene;silicic acid;sulfane |
| PubChem CID | 174871791 |
| Molecular Formula | C9H16O4SSi |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | prop-2-enylbenzene;silicic acid;sulfane |
| SMILES | C=CCc1ccccc1.O[Si](O)(O)O.S |
| InChI | InChI=1S/C9H10.H4O4Si.H2S/c1-2-6-9-7-4-3-5-8-9;1-5(2,3)4;/h2-5,7-8H,1,6H2;1-4H;1H2 |
| InChIKey | UTHFTFDAAYNFDE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enylbenzene;silicic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enylbenzene;silicic acid;sulfane?
The IUPAC name of prop-2-enylbenzene;silicic acid;sulfane (CID 174871791) is prop-2-enylbenzene;silicic acid;sulfane.
What is the SMILES notation for prop-2-enylbenzene;silicic acid;sulfane?
The canonical SMILES for prop-2-enylbenzene;silicic acid;sulfane is C=CCc1ccccc1.O[Si](O)(O)O.S.
What is the InChIKey of prop-2-enylbenzene;silicic acid;sulfane?
The InChIKey is UTHFTFDAAYNFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.H4O4Si.H2S/c1-2-6-9-7-4-3-5-8-9;1-5(2,3)4;/h2-5,7-8H,1,6H2;1-4H;1H2.
What are the key properties of prop-2-enylbenzene;silicic acid;sulfane?
prop-2-enylbenzene;silicic acid;sulfane has a molecular weight of 248.38 g/mol, XLogP of -0.08, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enylbenzene;silicic acid;sulfane is sourced from PubChem (CID 174871791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).