About benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene
benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene (PubChem CID 173443660) has the molecular formula C15H18O2P+
and a molecular weight of 261.28 g/mol. Its IUPAC name is benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene.
Molecular Properties
| Compound Name | benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene |
| PubChem CID | 173443660 |
| Molecular Formula | C15H18O2P+ |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1.O=[PH+]O.c1ccccc1 |
| InChI | InChI=1S/C9H10.C6H6.HO2P/c1-2-6-9-7-4-3-5-8-9;1-2-4-6-5-3-1;1-3-2/h2-5,7-8H,1,6H2;1-6H;3H/p+1 |
| InChIKey | MASBFSVWPRJZIP-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene?
The IUPAC name of benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene (CID 173443660) is benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene.
What is the SMILES notation for benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene?
The canonical SMILES for benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene is C=CCc1ccccc1.O=[PH+]O.c1ccccc1.
What is the InChIKey of benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene?
The InChIKey is MASBFSVWPRJZIP-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10.C6H6.HO2P/c1-2-6-9-7-4-3-5-8-9;1-2-4-6-5-3-1;1-3-2/h2-5,7-8H,1,6H2;1-6H;3H/p+1.
What are the key properties of benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene?
benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene has a molecular weight of 261.28 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;hydroxy(oxo)phosphanium;prop-2-enylbenzene is sourced from PubChem (CID 173443660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).