About carbonic acid;2-chlorophenol
carbonic acid;2-chlorophenol (PubChem CID 163958261) has the molecular formula C7H7ClO4
and a molecular weight of 190.58 g/mol. Its IUPAC name is carbonic acid;2-chlorophenol.
Molecular Properties
| Compound Name | carbonic acid;2-chlorophenol |
| PubChem CID | 163958261 |
| Molecular Formula | C7H7ClO4 |
| Molecular Weight | 190.58 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | carbonic acid;2-chlorophenol |
| SMILES | O=C(O)O.Oc1ccccc1Cl |
| InChI | InChI=1S/C6H5ClO.CH2O3/c7-5-3-1-2-4-6(5)8;2-1(3)4/h1-4,8H;(H2,2,3,4) |
| InChIKey | SFGXANUNHRTEJQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.58 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbonic acid;2-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;2-chlorophenol?
The IUPAC name of carbonic acid;2-chlorophenol (CID 163958261) is carbonic acid;2-chlorophenol.
What is the SMILES notation for carbonic acid;2-chlorophenol?
The canonical SMILES for carbonic acid;2-chlorophenol is O=C(O)O.Oc1ccccc1Cl.
What is the InChIKey of carbonic acid;2-chlorophenol?
The InChIKey is SFGXANUNHRTEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO.CH2O3/c7-5-3-1-2-4-6(5)8;2-1(3)4/h1-4,8H;(H2,2,3,4).
What are the key properties of carbonic acid;2-chlorophenol?
carbonic acid;2-chlorophenol has a molecular weight of 190.58 g/mol, XLogP of 2.27, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;2-chlorophenol is sourced from PubChem (CID 163958261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).