C7H6Cl3NO3 — CID 175495912
carbonic acid;N,N,2-trichloroaniline (PubChem CID 175495912) has the molecular formula C7H6Cl3NO3 and a molecular weight of 258.49 g/mol. Its IUPAC name is carbonic acid;N,N,2-trichloroaniline.
| Compound Name | carbonic acid;N,N,2-trichloroaniline |
|---|---|
| PubChem CID | 175495912 |
| Molecular Formula | C7H6Cl3NO3 |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 256.94 |
| IUPAC Name | carbonic acid;N,N,2-trichloroaniline |
| SMILES | Clc1ccccc1N(Cl)Cl.O=C(O)O |
| InChI | InChI=1S/C6H4Cl3N.CH2O3/c7-5-3-1-2-4-6(5)10(8)9;2-1(3)4/h1-4H;(H2,2,3,4) |
| InChIKey | JRZWIBDILGSVAX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|