C6H5Cl4N — CID 88693018
N,N,2-trichloroaniline;hydrochloride (PubChem CID 88693018) has the molecular formula C6H5Cl4N and a molecular weight of 232.93 g/mol. Its IUPAC name is N,N,2-trichloroaniline;hydrochloride.
| Compound Name | N,N,2-trichloroaniline;hydrochloride |
|---|---|
| PubChem CID | 88693018 |
| Molecular Formula | C6H5Cl4N |
| Molecular Weight | 232.93 g/mol |
| Exact Mass | 230.92 |
| IUPAC Name | N,N,2-trichloroaniline;hydrochloride |
| SMILES | Cl.Clc1ccccc1N(Cl)Cl |
| InChI | InChI=1S/C6H4Cl3N.ClH/c7-5-3-1-2-4-6(5)10(8)9;/h1-4H;1H |
| InChIKey | NHDCWIMNPDKBKA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.93 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|