About N,N,2-trichloroaniline;hydrochloride
N,N,2-trichloroaniline;hydrochloride (PubChem CID 88693018) has the molecular formula C6H5Cl4N
and a molecular weight of 232.93 g/mol. Its IUPAC name is N,N,2-trichloroaniline;hydrochloride.
Molecular Properties
| Compound Name | N,N,2-trichloroaniline;hydrochloride |
| PubChem CID | 88693018 |
| Molecular Formula | C6H5Cl4N |
| Molecular Weight | 232.93 g/mol |
| Exact Mass | 230.92 |
| IUPAC Name | N,N,2-trichloroaniline;hydrochloride |
| SMILES | Cl.Clc1ccccc1N(Cl)Cl |
| InChI | InChI=1S/C6H4Cl3N.ClH/c7-5-3-1-2-4-6(5)10(8)9;/h1-4H;1H |
| InChIKey | NHDCWIMNPDKBKA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.93 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N,2-trichloroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trichloroaniline;hydrochloride?
The IUPAC name of N,N,2-trichloroaniline;hydrochloride (CID 88693018) is N,N,2-trichloroaniline;hydrochloride.
What is the SMILES notation for N,N,2-trichloroaniline;hydrochloride?
The canonical SMILES for N,N,2-trichloroaniline;hydrochloride is Cl.Clc1ccccc1N(Cl)Cl.
What is the InChIKey of N,N,2-trichloroaniline;hydrochloride?
The InChIKey is NHDCWIMNPDKBKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl3N.ClH/c7-5-3-1-2-4-6(5)10(8)9;/h1-4H;1H.
What are the key properties of N,N,2-trichloroaniline;hydrochloride?
N,N,2-trichloroaniline;hydrochloride has a molecular weight of 232.93 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trichloroaniline;hydrochloride is sourced from PubChem (CID 88693018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).