C6H4Cl3N — CID 12471
2,4,6-trichloroaniline (PubChem CID 12471) has the molecular formula C6H4Cl3N and a molecular weight of 196.46 g/mol. Its IUPAC name is 2,4,6-trichloroaniline.
| Compound Name | 2,4,6-trichloroaniline |
|---|---|
| PubChem CID | 12471 |
| Molecular Formula | C6H4Cl3N |
| Molecular Weight | 196.46 g/mol |
| Exact Mass | 194.94 |
| IUPAC Name | 2,4,6-trichloroaniline |
| SMILES | Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C6H4Cl3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| InChIKey | NATVSFWWYVJTAZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|