C22H19ClO — CID 88755430
2-chlorophenol;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 88755430) has the molecular formula C22H19ClO and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-chlorophenol;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | 2-chlorophenol;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 88755430 |
| Molecular Formula | C22H19ClO |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-chlorophenol;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | C(/C=C/c1ccccc1)=C\c1ccccc1.Oc1ccccc1Cl |
| InChI | InChI=1S/C16H14.C6H5ClO/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;7-5-3-1-2-4-6(5)8/h1-14H;1-4,8H/b13-7+,14-8+; |
| InChIKey | WXGKGOHOAWWCFP-IOJPAMHKSA-N |
| XLogP | 6.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|