C28H27N — CID 88641143
azane;1,1'-biphenyl;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 88641143) has the molecular formula C28H27N and a molecular weight of 377.53 g/mol. Its IUPAC name is azane;1,1'-biphenyl;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | azane;1,1'-biphenyl;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 88641143 |
| Molecular Formula | C28H27N |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | azane;1,1'-biphenyl;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | C(/C=C/c1ccccc1)=C\c1ccccc1.N.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14.C12H10.H3N/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-14H;1-10H;1H3/b13-7+,14-8+;; |
| InChIKey | HYXVFJRFSSCXMJ-SOUIOMOHSA-N |
| XLogP | 7.93 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|