About 4-(4-phenylbuta-1,3-dienyl)benzaldehyde
4-(4-phenylbuta-1,3-dienyl)benzaldehyde (PubChem CID 71360938) has the molecular formula C17H14O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-(4-phenylbuta-1,3-dienyl)benzaldehyde.
Molecular Properties
| Compound Name | 4-(4-phenylbuta-1,3-dienyl)benzaldehyde |
| PubChem CID | 71360938 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-(4-phenylbuta-1,3-dienyl)benzaldehyde |
| SMILES | O=Cc1ccc(C=CC=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H14O/c18-14-17-12-10-16(11-13-17)9-5-4-8-15-6-2-1-3-7-15/h1-14H |
| InChIKey | JWMYOPCQYPDAER-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-phenylbuta-1,3-dienyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-phenylbuta-1,3-dienyl)benzaldehyde?
The IUPAC name of 4-(4-phenylbuta-1,3-dienyl)benzaldehyde (CID 71360938) is 4-(4-phenylbuta-1,3-dienyl)benzaldehyde.
What is the SMILES notation for 4-(4-phenylbuta-1,3-dienyl)benzaldehyde?
The canonical SMILES for 4-(4-phenylbuta-1,3-dienyl)benzaldehyde is O=Cc1ccc(C=CC=Cc2ccccc2)cc1.
What is the InChIKey of 4-(4-phenylbuta-1,3-dienyl)benzaldehyde?
The InChIKey is JWMYOPCQYPDAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O/c18-14-17-12-10-16(11-13-17)9-5-4-8-15-6-2-1-3-7-15/h1-14H.
What are the key properties of 4-(4-phenylbuta-1,3-dienyl)benzaldehyde?
4-(4-phenylbuta-1,3-dienyl)benzaldehyde has a molecular weight of 234.30 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-phenylbuta-1,3-dienyl)benzaldehyde is sourced from PubChem (CID 71360938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).