About benzene;terephthalaldehyde
benzene;terephthalaldehyde (PubChem CID 163498156) has the molecular formula C14H12O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is benzene;terephthalaldehyde.
Molecular Properties
| Compound Name | benzene;terephthalaldehyde |
| PubChem CID | 163498156 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | benzene;terephthalaldehyde |
| SMILES | O=Cc1ccc(C=O)cc1.c1ccccc1 |
| InChI | InChI=1S/C8H6O2.C6H6/c9-5-7-1-2-8(6-10)4-3-7;1-2-4-6-5-3-1/h1-6H;1-6H |
| InChIKey | CSLOCCWAGUHPQD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzene;terephthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;terephthalaldehyde?
The IUPAC name of benzene;terephthalaldehyde (CID 163498156) is benzene;terephthalaldehyde.
What is the SMILES notation for benzene;terephthalaldehyde?
The canonical SMILES for benzene;terephthalaldehyde is O=Cc1ccc(C=O)cc1.c1ccccc1.
What is the InChIKey of benzene;terephthalaldehyde?
The InChIKey is CSLOCCWAGUHPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.C6H6/c9-5-7-1-2-8(6-10)4-3-7;1-2-4-6-5-3-1/h1-6H;1-6H.
What are the key properties of benzene;terephthalaldehyde?
benzene;terephthalaldehyde has a molecular weight of 212.25 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;terephthalaldehyde is sourced from PubChem (CID 163498156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).