About carbon monoxide;chromium;terephthalaldehyde
carbon monoxide;chromium;terephthalaldehyde (PubChem CID 11108406) has the molecular formula C11H6CrO5
and a molecular weight of 270.16 g/mol. Its IUPAC name is carbon monoxide;chromium;terephthalaldehyde.
Molecular Properties
| Compound Name | carbon monoxide;chromium;terephthalaldehyde |
| PubChem CID | 11108406 |
| Molecular Formula | C11H6CrO5 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | carbon monoxide;chromium;terephthalaldehyde |
| SMILES | O=Cc1ccc(C=O)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C8H6O2.3CO.Cr/c9-5-7-1-2-8(6-10)4-3-7;3*1-2;/h1-6H;;;; |
| InChIKey | ZANGGYYNSDYJOG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 93.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;chromium;terephthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;chromium;terephthalaldehyde?
The IUPAC name of carbon monoxide;chromium;terephthalaldehyde (CID 11108406) is carbon monoxide;chromium;terephthalaldehyde.
What is the SMILES notation for carbon monoxide;chromium;terephthalaldehyde?
The canonical SMILES for carbon monoxide;chromium;terephthalaldehyde is O=Cc1ccc(C=O)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;terephthalaldehyde?
The InChIKey is ZANGGYYNSDYJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.3CO.Cr/c9-5-7-1-2-8(6-10)4-3-7;3*1-2;/h1-6H;;;;.
What are the key properties of carbon monoxide;chromium;terephthalaldehyde?
carbon monoxide;chromium;terephthalaldehyde has a molecular weight of 270.16 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;terephthalaldehyde is sourced from PubChem (CID 11108406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).