About 4-aminobenzaldehyde
4-aminobenzaldehyde (PubChem CID 174906134) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-aminobenzaldehyde.
Molecular Properties
| Compound Name | 4-aminobenzaldehyde |
| PubChem CID | 174906134 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-aminobenzaldehyde |
| SMILES | Nc1ccc(C=O)cc1.Nc1ccc(C=O)cc1 |
| InChI | InChI=1S/2C7H7NO/c2*8-7-3-1-6(5-9)2-4-7/h2*1-5H,8H2 |
| InChIKey | GMDXVENEISVJKB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzaldehyde?
The IUPAC name of 4-aminobenzaldehyde (CID 174906134) is 4-aminobenzaldehyde.
What is the SMILES notation for 4-aminobenzaldehyde?
The canonical SMILES for 4-aminobenzaldehyde is Nc1ccc(C=O)cc1.Nc1ccc(C=O)cc1.
What is the InChIKey of 4-aminobenzaldehyde?
The InChIKey is GMDXVENEISVJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7NO/c2*8-7-3-1-6(5-9)2-4-7/h2*1-5H,8H2.
What are the key properties of 4-aminobenzaldehyde?
4-aminobenzaldehyde has a molecular weight of 242.28 g/mol, XLogP of 2.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzaldehyde is sourced from PubChem (CID 174906134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).