About 4-formylbenzenediazonium
4-formylbenzenediazonium (PubChem CID 12918663) has the molecular formula C7H5N2O+
and a molecular weight of 133.13 g/mol. Its IUPAC name is 4-formylbenzenediazonium.
Molecular Properties
| Compound Name | 4-formylbenzenediazonium |
| PubChem CID | 12918663 |
| Molecular Formula | C7H5N2O+ |
| Molecular Weight | 133.13 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | 4-formylbenzenediazonium |
| SMILES | N#[N+]c1ccc(C=O)cc1 |
| InChI | InChI=1S/C7H5N2O/c8-9-7-3-1-6(5-10)2-4-7/h1-5H/q+1 |
| InChIKey | WPNZCFMIGPCUJA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-formylbenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formylbenzenediazonium?
The IUPAC name of 4-formylbenzenediazonium (CID 12918663) is 4-formylbenzenediazonium.
What is the SMILES notation for 4-formylbenzenediazonium?
The canonical SMILES for 4-formylbenzenediazonium is N#[N+]c1ccc(C=O)cc1.
What is the InChIKey of 4-formylbenzenediazonium?
The InChIKey is WPNZCFMIGPCUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2O/c8-9-7-3-1-6(5-10)2-4-7/h1-5H/q+1.
What are the key properties of 4-formylbenzenediazonium?
4-formylbenzenediazonium has a molecular weight of 133.13 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formylbenzenediazonium is sourced from PubChem (CID 12918663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).