About 4-formylbenzonitrile;methane
4-formylbenzonitrile;methane (PubChem CID 143070509) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-formylbenzonitrile;methane.
Molecular Properties
| Compound Name | 4-formylbenzonitrile;methane |
| PubChem CID | 143070509 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 4-formylbenzonitrile;methane |
| SMILES | C.N#Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C8H5NO.CH4/c9-5-7-1-3-8(6-10)4-2-7;/h1-4,6H;1H4 |
| InChIKey | XMEBESSMSLGHBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formylbenzonitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formylbenzonitrile;methane?
The IUPAC name of 4-formylbenzonitrile;methane (CID 143070509) is 4-formylbenzonitrile;methane.
What is the SMILES notation for 4-formylbenzonitrile;methane?
The canonical SMILES for 4-formylbenzonitrile;methane is C.N#Cc1ccc(C=O)cc1.
What is the InChIKey of 4-formylbenzonitrile;methane?
The InChIKey is XMEBESSMSLGHBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.CH4/c9-5-7-1-3-8(6-10)4-2-7;/h1-4,6H;1H4.
What are the key properties of 4-formylbenzonitrile;methane?
4-formylbenzonitrile;methane has a molecular weight of 147.18 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formylbenzonitrile;methane is sourced from PubChem (CID 143070509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).