C15H8N2O2 — CID 175192999
2-(4-formylphenoxy)benzene-1,4-dicarbonitrile (PubChem CID 175192999) has the molecular formula C15H8N2O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-(4-formylphenoxy)benzene-1,4-dicarbonitrile.
| Compound Name | 2-(4-formylphenoxy)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 175192999 |
| Molecular Formula | C15H8N2O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(4-formylphenoxy)benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1ccc(C#N)c(Oc2ccc(C=O)cc2)c1 |
| InChI | InChI=1S/C15H8N2O2/c16-8-12-1-4-13(9-17)15(7-12)19-14-5-2-11(10-18)3-6-14/h1-7,10H |
| InChIKey | BTDWAQGOPUIIAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|