C38H41N3O — CID 158727090
4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzaldehyde;4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzonitrile (PubChem CID 158727090) has the molecular formula C38H41N3O and a molecular weight of 555.77 g/mol. Its IUPAC name is 4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzaldehyde;4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzaldehyde;4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 158727090 |
| Molecular Formula | C38H41N3O |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzaldehyde;4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]benzonitrile |
| SMILES | CCN(CC)c1ccc(/C=C/c2ccc(C#N)cc2)cc1.CCN(CC)c1ccc(/C=C/c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C19H20N2.C19H21NO/c1-3-21(4-2)19-13-11-17(12-14-19)6-5-16-7-9-18(15-20)10-8-16;1-3-20(4-2)19-13-11-17(12-14-19)6-5-16-7-9-18(15-21)10-8-16/h5-14H,3-4H2,1-2H3;5-15H,3-4H2,1-2H3/b2*6-5+ |
| InChIKey | IKQIUJFWQZMOQP-HBVWGTQWSA-N |
| XLogP | 9.09 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|