C45H33NO3 — CID 85434462
4-[2-[4-[4-[2-(4-formylphenyl)ethenyl]-N-[4-[2-(4-formylphenyl)ethenyl]phenyl]anilino]phenyl]ethenyl]benzaldehyde (PubChem CID 85434462) has the molecular formula C45H33NO3 and a molecular weight of 635.76 g/mol. Its IUPAC name is 4-[2-[4-[4-[2-(4-formylphenyl)ethenyl]-N-[4-[2-(4-formylphenyl)ethenyl]phenyl]anilino]phenyl]ethenyl]benzaldehyde.
| Compound Name | 4-[2-[4-[4-[2-(4-formylphenyl)ethenyl]-N-[4-[2-(4-formylphenyl)ethenyl]phenyl]anilino]phenyl]ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 85434462 |
| Molecular Formula | C45H33NO3 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 4-[2-[4-[4-[2-(4-formylphenyl)ethenyl]-N-[4-[2-(4-formylphenyl)ethenyl]phenyl]anilino]phenyl]ethenyl]benzaldehyde |
| SMILES | O=Cc1ccc(C=Cc2ccc(N(c3ccc(C=Cc4ccc(C=O)cc4)cc3)c3ccc(C=Cc4ccc(C=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H33NO3/c47-31-40-13-7-34(8-14-40)1-4-37-19-25-43(26-20-37)46(44-27-21-38(22-28-44)5-2-35-9-15-41(32-48)16-10-35)45-29-23-39(24-30-45)6-3-36-11-17-42(33-49)18-12-36/h1-33H |
| InChIKey | DEDDWTRAIXDKRW-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|