C37H25F6NO5S2 — CID 139258657
4-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]-N-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]anilino]benzaldehyde (PubChem CID 139258657) has the molecular formula C37H25F6NO5S2 and a molecular weight of 741.73 g/mol. Its IUPAC name is 4-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]-N-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]anilino]benzaldehyde.
| Compound Name | 4-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]-N-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]anilino]benzaldehyde |
|---|---|
| PubChem CID | 139258657 |
| Molecular Formula | C37H25F6NO5S2 |
| Molecular Weight | 741.73 g/mol |
| Exact Mass | 741.11 |
| IUPAC Name | 4-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]-N-[4-[(E)-2-[4-(trifluoromethylsulfonyl)phenyl]ethenyl]phenyl]anilino]benzaldehyde |
| SMILES | O=Cc1ccc(N(c2ccc(/C=C/c3ccc(S(=O)(=O)C(F)(F)F)cc3)cc2)c2ccc(/C=C/c3ccc(S(=O)(=O)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H25F6NO5S2/c38-36(39,40)50(46,47)34-21-11-28(12-22-34)3-1-26-5-15-31(16-6-26)44(33-19-9-30(25-45)10-20-33)32-17-7-27(8-18-32)2-4-29-13-23-35(24-14-29)51(48,49)37(41,42)43/h1-25H/b3-1+,4-2+ |
| InChIKey | BAQOHUZXPUHECF-ZPUQHVIOSA-N |
| XLogP | 9.90 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.73 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|