C48H27F18N — CID 59858823
4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-N,N-bis[4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]aniline (PubChem CID 59858823) has the molecular formula C48H27F18N and a molecular weight of 959.71 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-N,N-bis[4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]aniline.
| Compound Name | 4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-N,N-bis[4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59858823 |
| Molecular Formula | C48H27F18N |
| Molecular Weight | 959.71 g/mol |
| Exact Mass | 959.19 |
| IUPAC Name | 4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-N,N-bis[4-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]aniline |
| SMILES | FC(F)(F)c1cc(/C=C/c2ccc(N(c3ccc(/C=C/c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)c3ccc(/C=C/c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C48H27F18N/c49-43(50,51)34-19-31(20-35(25-34)44(52,53)54)4-1-28-7-13-40(14-8-28)67(41-15-9-29(10-16-41)2-5-32-21-36(45(55,56)57)26-37(22-32)46(58,59)60)42-17-11-30(12-18-42)3-6-33-23-38(47(61,62)63)27-39(24-33)48(64,65)66/h1-27H/b4-1+,5-2+,6-3+ |
| InChIKey | HMDCRWIMEMDUDO-GZDDRBCLSA-N |
| XLogP | 17.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.71 |
| LogP ≤ 5 | 17.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|