C16H9F7 — CID 175767255
1-[2-(3-fluorophenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 175767255) has the molecular formula C16H9F7 and a molecular weight of 334.23 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[2-(3-fluorophenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 175767255 |
| Molecular Formula | C16H9F7 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | Fc1cccc(C=Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H9F7/c17-14-3-1-2-10(8-14)4-5-11-6-12(15(18,19)20)9-13(7-11)16(21,22)23/h1-9H |
| InChIKey | YIXODFAXQFDGFU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|