C14H11FO2 — CID 75071270
5-[2-(3-fluorophenyl)ethenyl]benzene-1,3-diol (PubChem CID 75071270) has the molecular formula C14H11FO2 and a molecular weight of 230.24 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[2-(3-fluorophenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 75071270 |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-[2-(3-fluorophenyl)ethenyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(C=Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C14H11FO2/c15-12-3-1-2-10(6-12)4-5-11-7-13(16)9-14(17)8-11/h1-9,16-17H |
| InChIKey | MMDDHOZYUASFIP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|