C20H21FO2 — CID 170350956
2-cyclohexyl-5-[(E)-2-(3-fluorophenyl)ethenyl]benzene-1,3-diol (PubChem CID 170350956) has the molecular formula C20H21FO2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-cyclohexyl-5-[(E)-2-(3-fluorophenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 2-cyclohexyl-5-[(E)-2-(3-fluorophenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 170350956 |
| Molecular Formula | C20H21FO2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-cyclohexyl-5-[(E)-2-(3-fluorophenyl)ethenyl]benzene-1,3-diol |
| SMILES | Oc1cc(/C=C/c2cccc(F)c2)cc(O)c1C1CCCCC1 |
| InChI | InChI=1S/C20H21FO2/c21-17-8-4-5-14(11-17)9-10-15-12-18(22)20(19(23)13-15)16-6-2-1-3-7-16/h4-5,8-13,16,22-23H,1-3,6-7H2/b10-9+ |
| InChIKey | JWSKDRLJVZCGLE-MDZDMXLPSA-N |
| XLogP | 5.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|