C12H13FO — CID 134847394
2-[2-(3-fluorophenyl)ethenyl]oxolane (PubChem CID 134847394) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethenyl]oxolane.
| Compound Name | 2-[2-(3-fluorophenyl)ethenyl]oxolane |
|---|---|
| PubChem CID | 134847394 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethenyl]oxolane |
| SMILES | Fc1cccc(C=CC2CCCO2)c1 |
| InChI | InChI=1S/C12H13FO/c13-11-4-1-3-10(9-11)6-7-12-5-2-8-14-12/h1,3-4,6-7,9,12H,2,5,8H2 |
| InChIKey | SRYUSLRZJFJMNN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |