C20H20F2O2 — CID 170351252
2-cyclohexyl-5-[2-(3,4-difluorophenyl)ethenyl]benzene-1,3-diol (PubChem CID 170351252) has the molecular formula C20H20F2O2 and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-cyclohexyl-5-[2-(3,4-difluorophenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 2-cyclohexyl-5-[2-(3,4-difluorophenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 170351252 |
| Molecular Formula | C20H20F2O2 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-cyclohexyl-5-[2-(3,4-difluorophenyl)ethenyl]benzene-1,3-diol |
| SMILES | Oc1cc(C=Cc2ccc(F)c(F)c2)cc(O)c1C1CCCCC1 |
| InChI | InChI=1S/C20H20F2O2/c21-16-9-8-13(10-17(16)22)6-7-14-11-18(23)20(19(24)12-14)15-4-2-1-3-5-15/h6-12,15,23-24H,1-5H2 |
| InChIKey | LYXYCUHXQNGSCT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|