C14H16F2N2O — CID 9465740
N-[(Z)-(3,4-difluorophenyl)methylideneamino]cyclohexanecarboxamide (PubChem CID 9465740) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is N-[(Z)-(3,4-difluorophenyl)methylideneamino]cyclohexanecarboxamide.
| Compound Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 9465740 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]cyclohexanecarboxamide |
| SMILES | O=C(N/N=C\c1ccc(F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C14H16F2N2O/c15-12-7-6-10(8-13(12)16)9-17-18-14(19)11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H,18,19)/b17-9- |
| InChIKey | KOETZXBPADAFEG-MFOYZWKCSA-N |
| XLogP | 3.00 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|