C17H22N2O4 — CID 5419986
[4-[(Z)-(cyclohexanecarbonylhydrazinylidene)methyl]-2-methoxyphenyl] acetate (PubChem CID 5419986) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [4-[(Z)-(cyclohexanecarbonylhydrazinylidene)methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-(cyclohexanecarbonylhydrazinylidene)methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 5419986 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [4-[(Z)-(cyclohexanecarbonylhydrazinylidene)methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\NC(=O)C2CCCCC2)ccc1OC(C)=O |
| InChI | InChI=1S/C17H22N2O4/c1-12(20)23-15-9-8-13(10-16(15)22-2)11-18-19-17(21)14-6-4-3-5-7-14/h8-11,14H,3-7H2,1-2H3,(H,19,21)/b18-11- |
| InChIKey | YODGXESDDZDJKJ-WQRHYEAKSA-N |
| XLogP | 2.65 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|