C17H13FO2 — CID 56839366
(1E,4E)-1-(3-fluorophenyl)-5-(3-hydroxyphenyl)penta-1,4-dien-3-one (PubChem CID 56839366) has the molecular formula C17H13FO2 and a molecular weight of 268.29 g/mol. Its IUPAC name is (1E,4E)-1-(3-fluorophenyl)-5-(3-hydroxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(3-fluorophenyl)-5-(3-hydroxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 56839366 |
| Molecular Formula | C17H13FO2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (1E,4E)-1-(3-fluorophenyl)-5-(3-hydroxyphenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1cccc(O)c1)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C17H13FO2/c18-15-5-1-3-13(11-15)7-9-16(19)10-8-14-4-2-6-17(20)12-14/h1-12,20H/b9-7+,10-8+ |
| InChIKey | PBZJIEJVHIXYTH-FIFLTTCUSA-N |
| XLogP | 3.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|