C17H13FO3 — CID 177386044
(1Z,4E)-5-(3-fluorophenyl)-1-hydroxy-1-(2-hydroxyphenyl)penta-1,4-dien-3-one (PubChem CID 177386044) has the molecular formula C17H13FO3 and a molecular weight of 284.29 g/mol. Its IUPAC name is (1Z,4E)-5-(3-fluorophenyl)-1-hydroxy-1-(2-hydroxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-5-(3-fluorophenyl)-1-hydroxy-1-(2-hydroxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 177386044 |
| Molecular Formula | C17H13FO3 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (1Z,4E)-5-(3-fluorophenyl)-1-hydroxy-1-(2-hydroxyphenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C(\O)c1ccccc1O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C17H13FO3/c18-13-5-3-4-12(10-13)8-9-14(19)11-17(21)15-6-1-2-7-16(15)20/h1-11,20-21H/b9-8+,17-11- |
| InChIKey | FBDKPPZSLALVDI-JMAVEDQASA-N |
| XLogP | 3.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|