C15H10F2O3 — CID 6927928
(Z)-1-(2,6-difluorophenyl)-3-hydroxy-3-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 6927928) has the molecular formula C15H10F2O3 and a molecular weight of 276.24 g/mol. Its IUPAC name is (Z)-1-(2,6-difluorophenyl)-3-hydroxy-3-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-1-(2,6-difluorophenyl)-3-hydroxy-3-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6927928 |
| Molecular Formula | C15H10F2O3 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (Z)-1-(2,6-difluorophenyl)-3-hydroxy-3-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C(\O)c1ccccc1O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H10F2O3/c16-10-5-3-6-11(17)15(10)14(20)8-13(19)9-4-1-2-7-12(9)18/h1-8,18-19H/b13-8- |
| InChIKey | BMJJCKMNADLNEI-JYRVWZFOSA-N |
| XLogP | 3.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|