C19H16O2 — CID 6474898
(1E,4Z,6E)-5-hydroxy-1,7-diphenylhepta-1,4,6-trien-3-one (PubChem CID 6474898) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (1E,4Z,6E)-5-hydroxy-1,7-diphenylhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-hydroxy-1,7-diphenylhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 6474898 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1E,4Z,6E)-5-hydroxy-1,7-diphenylhepta-1,4,6-trien-3-one |
| SMILES | O=C(/C=C(O)/C=C/c1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H16O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-15,20H/b13-11+,14-12+,18-15- |
| InChIKey | DMZJFBKOUHBFQM-OCPBWFIYSA-N |
| XLogP | 4.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|