C30H23F6N — CID 138690611
N-[4-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]-3-methyl-N-(4-methylphenyl)aniline (PubChem CID 138690611) has the molecular formula C30H23F6N and a molecular weight of 511.51 g/mol. Its IUPAC name is N-[4-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]-3-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]-3-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 138690611 |
| Molecular Formula | C30H23F6N |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | N-[4-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]phenyl]-3-methyl-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C=Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C30H23F6N/c1-20-6-12-26(13-7-20)37(28-5-3-4-21(2)16-28)27-14-10-22(11-15-27)8-9-23-17-24(29(31,32)33)19-25(18-23)30(34,35)36/h3-19H,1-2H3 |
| InChIKey | NSZKIQMPOUUZEN-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|