C42H27F6N — CID 72575215
4-[2-(3,5-difluorophenyl)ethenyl]-N,N-bis[4-[2-(3,5-difluorophenyl)ethenyl]phenyl]aniline (PubChem CID 72575215) has the molecular formula C42H27F6N and a molecular weight of 659.67 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenyl)ethenyl]-N,N-bis[4-[2-(3,5-difluorophenyl)ethenyl]phenyl]aniline.
| Compound Name | 4-[2-(3,5-difluorophenyl)ethenyl]-N,N-bis[4-[2-(3,5-difluorophenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 72575215 |
| Molecular Formula | C42H27F6N |
| Molecular Weight | 659.67 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | 4-[2-(3,5-difluorophenyl)ethenyl]-N,N-bis[4-[2-(3,5-difluorophenyl)ethenyl]phenyl]aniline |
| SMILES | Fc1cc(F)cc(C=Cc2ccc(N(c3ccc(C=Cc4cc(F)cc(F)c4)cc3)c3ccc(C=Cc4cc(F)cc(F)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C42H27F6N/c43-34-19-31(20-35(44)25-34)4-1-28-7-13-40(14-8-28)49(41-15-9-29(10-16-41)2-5-32-21-36(45)26-37(46)22-32)42-17-11-30(12-18-42)3-6-33-23-38(47)27-39(48)24-33/h1-27H |
| InChIKey | GEGBNVDQQLGXCX-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.67 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|