C54H54F3N — CID 59838894
4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]-N,N-bis[4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]phenyl]aniline (PubChem CID 59838894) has the molecular formula C54H54F3N and a molecular weight of 774.03 g/mol. Its IUPAC name is 4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]-N,N-bis[4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]phenyl]aniline.
| Compound Name | 4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]-N,N-bis[4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59838894 |
| Molecular Formula | C54H54F3N |
| Molecular Weight | 774.03 g/mol |
| Exact Mass | 773.42 |
| IUPAC Name | 4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]-N,N-bis[4-[(E)-2-(3-tert-butyl-4-fluorophenyl)ethenyl]phenyl]aniline |
| SMILES | CC(C)(C)c1cc(/C=C/c2ccc(N(c3ccc(/C=C/c4ccc(F)c(C(C)(C)C)c4)cc3)c3ccc(/C=C/c4ccc(F)c(C(C)(C)C)c4)cc3)cc2)ccc1F |
| InChI | InChI=1S/C54H54F3N/c1-52(2,3)46-34-40(22-31-49(46)55)13-10-37-16-25-43(26-17-37)58(44-27-18-38(19-28-44)11-14-41-23-32-50(56)47(35-41)53(4,5)6)45-29-20-39(21-30-45)12-15-42-24-33-51(57)48(36-42)54(7,8)9/h10-36H,1-9H3/b13-10+,14-11+,15-12+ |
| InChIKey | ZLWLRJPPTMJOSA-DZURWXOBSA-N |
| XLogP | 15.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.03 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|