C53H57NSi — CID 59838914
4-[(E)-2-(4-tert-butylphenyl)ethenyl]-N-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-N-[4-[(E)-2-(4-trimethylsilylphenyl)ethenyl]phenyl]aniline (PubChem CID 59838914) has the molecular formula C53H57NSi and a molecular weight of 736.13 g/mol. Its IUPAC name is 4-[(E)-2-(4-tert-butylphenyl)ethenyl]-N-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-N-[4-[(E)-2-(4-trimethylsilylphenyl)ethenyl]phenyl]aniline.
| Compound Name | 4-[(E)-2-(4-tert-butylphenyl)ethenyl]-N-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-N-[4-[(E)-2-(4-trimethylsilylphenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59838914 |
| Molecular Formula | C53H57NSi |
| Molecular Weight | 736.13 g/mol |
| Exact Mass | 735.43 |
| IUPAC Name | 4-[(E)-2-(4-tert-butylphenyl)ethenyl]-N-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-N-[4-[(E)-2-(4-trimethylsilylphenyl)ethenyl]phenyl]aniline |
| SMILES | CC(C)(C)c1ccc(/C=C/c2ccc(N(c3ccc(/C=C/c4ccc(C(C)(C)C)cc4)cc3)c3ccc(/C=C/c4ccc([Si](C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C53H57NSi/c1-52(2,3)46-28-16-40(17-29-46)10-12-42-20-32-48(33-21-42)54(49-34-22-43(23-35-49)13-11-41-18-30-47(31-19-41)53(4,5)6)50-36-24-44(25-37-50)14-15-45-26-38-51(39-27-45)55(7,8)9/h10-39H,1-9H3/b12-10+,13-11+,15-14+ |
| InChIKey | ADBKQNKNZVCOCS-ODMYBPKPSA-N |
| XLogP | 14.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.13 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|