C64H63NSiSn — CID 58132054
N-[4-[3-(4-tert-butylphenyl)phenyl]phenyl]-4-[3-(4-trimethylsilylphenyl)phenyl]-N-[4-[3-(4-trimethylstannylphenyl)phenyl]phenyl]aniline (PubChem CID 58132054) has the molecular formula C64H63NSiSn and a molecular weight of 993.01 g/mol. Its IUPAC name is N-[4-[3-(4-tert-butylphenyl)phenyl]phenyl]-4-[3-(4-trimethylsilylphenyl)phenyl]-N-[4-[3-(4-trimethylstannylphenyl)phenyl]phenyl]aniline.
| Compound Name | N-[4-[3-(4-tert-butylphenyl)phenyl]phenyl]-4-[3-(4-trimethylsilylphenyl)phenyl]-N-[4-[3-(4-trimethylstannylphenyl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 58132054 |
| Molecular Formula | C64H63NSiSn |
| Molecular Weight | 993.01 g/mol |
| Exact Mass | 993.38 |
| IUPAC Name | N-[4-[3-(4-tert-butylphenyl)phenyl]phenyl]-4-[3-(4-trimethylsilylphenyl)phenyl]-N-[4-[3-(4-trimethylstannylphenyl)phenyl]phenyl]aniline |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3ccc(N(c4ccc(-c5cccc(-c6ccc([Si](C)(C)C)cc6)c5)cc4)c4ccc(-c5cccc(-c6ccc([Sn](C)(C)C)cc6)c5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C61H54NSi.3CH3.Sn/c1-61(2,3)56-31-21-45(22-32-56)51-16-11-18-53(42-51)47-25-35-58(36-26-47)62(57-33-23-46(24-34-57)52-17-10-15-50(41-52)44-13-8-7-9-14-44)59-37-27-48(28-38-59)54-19-12-20-55(43-54)49-29-39-60(40-30-49)63(4,5)6;;;;/h8-43H,1-6H3;3*1H3; |
| InChIKey | BHGSWUCUGKEJGL-UHFFFAOYSA-N |
| XLogP | 17.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.01 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|