C75H59NSi — CID 58132006
4-(2,5-diphenylphenyl)-N-[4-(2,5-diphenylphenyl)phenyl]-N-[4-[2-phenyl-5-(4-trimethylsilylphenyl)phenyl]phenyl]aniline (PubChem CID 58132006) has the molecular formula C75H59NSi and a molecular weight of 1002.39 g/mol. Its IUPAC name is 4-(2,5-diphenylphenyl)-N-[4-(2,5-diphenylphenyl)phenyl]-N-[4-[2-phenyl-5-(4-trimethylsilylphenyl)phenyl]phenyl]aniline.
| Compound Name | 4-(2,5-diphenylphenyl)-N-[4-(2,5-diphenylphenyl)phenyl]-N-[4-[2-phenyl-5-(4-trimethylsilylphenyl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 58132006 |
| Molecular Formula | C75H59NSi |
| Molecular Weight | 1002.39 g/mol |
| Exact Mass | 1001.44 |
| IUPAC Name | 4-(2,5-diphenylphenyl)-N-[4-(2,5-diphenylphenyl)phenyl]-N-[4-[2-phenyl-5-(4-trimethylsilylphenyl)phenyl]phenyl]aniline |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccccc3)c(-c3ccc(N(c4ccc(-c5cc(-c6ccccc6)ccc5-c5ccccc5)cc4)c4ccc(-c5cc(-c6ccccc6)ccc5-c5ccccc5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C75H59NSi/c1-77(2,3)69-46-35-56(36-47-69)65-39-50-72(59-27-17-8-18-28-59)75(53-65)62-33-44-68(45-34-62)76(66-40-29-60(30-41-66)73-51-63(54-19-9-4-10-20-54)37-48-70(73)57-23-13-6-14-24-57)67-42-31-61(32-43-67)74-52-64(55-21-11-5-12-22-55)38-49-71(74)58-25-15-7-16-26-58/h4-53H,1-3H3 |
| InChIKey | NNSXBIOCIQJNCQ-UHFFFAOYSA-N |
| XLogP | 20.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.39 |
| LogP ≤ 5 | 20.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|