C66H70N2Si4 — CID 59718300
6,12-diphenyl-2-N,2-N,8-N,8-N-tetrakis(4-trimethylsilylphenyl)chrysene-2,8-diamine (PubChem CID 59718300) has the molecular formula C66H70N2Si4 and a molecular weight of 1003.64 g/mol. Its IUPAC name is 6,12-diphenyl-2-N,2-N,8-N,8-N-tetrakis(4-trimethylsilylphenyl)chrysene-2,8-diamine.
| Compound Name | 6,12-diphenyl-2-N,2-N,8-N,8-N-tetrakis(4-trimethylsilylphenyl)chrysene-2,8-diamine |
|---|---|
| PubChem CID | 59718300 |
| Molecular Formula | C66H70N2Si4 |
| Molecular Weight | 1003.64 g/mol |
| Exact Mass | 1002.46 |
| IUPAC Name | 6,12-diphenyl-2-N,2-N,8-N,8-N-tetrakis(4-trimethylsilylphenyl)chrysene-2,8-diamine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccc([Si](C)(C)C)cc2)c2ccc3c(c2)c(-c2ccccc2)cc2c4ccc(N(c5ccc([Si](C)(C)C)cc5)c5ccc([Si](C)(C)C)cc5)cc4c(-c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C66H70N2Si4/c1-69(2,3)55-33-23-49(24-34-55)67(50-25-35-56(36-26-50)70(4,5)6)53-31-41-59-63(43-53)61(47-19-15-13-16-20-47)45-66-60-42-32-54(44-64(60)62(46-65(59)66)48-21-17-14-18-22-48)68(51-27-37-57(38-28-51)71(7,8)9)52-29-39-58(40-30-52)72(10,11)12/h13-46H,1-12H3 |
| InChIKey | TTYUTACNYSONML-UHFFFAOYSA-N |
| XLogP | 17.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.64 |
| LogP ≤ 5 | 17.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|