C60H56N2Si2 — CID 58383811
1-N,6-N-bis(3-methylphenyl)-3,8-diphenyl-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine (PubChem CID 58383811) has the molecular formula C60H56N2Si2 and a molecular weight of 861.29 g/mol. Its IUPAC name is 1-N,6-N-bis(3-methylphenyl)-3,8-diphenyl-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(3-methylphenyl)-3,8-diphenyl-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 58383811 |
| Molecular Formula | C60H56N2Si2 |
| Molecular Weight | 861.29 g/mol |
| Exact Mass | 860.40 |
| IUPAC Name | 1-N,6-N-bis(3-methylphenyl)-3,8-diphenyl-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
| SMILES | Cc1cccc(N(c2ccc([Si](C)(C)C)cc2)c2cc(-c3ccccc3)c3ccc4c(N(c5ccc([Si](C)(C)C)cc5)c5cccc(C)c5)cc(-c5ccccc5)c5ccc2c3c54)c1 |
| InChI | InChI=1S/C60H56N2Si2/c1-41-17-15-23-47(37-41)61(45-25-29-49(30-26-45)63(3,4)5)57-39-55(43-19-11-9-12-20-43)51-34-36-54-58(40-56(44-21-13-10-14-22-44)52-33-35-53(57)59(51)60(52)54)62(48-24-16-18-42(2)38-48)46-27-31-50(32-28-46)64(6,7)8/h9-40H,1-8H3 |
| InChIKey | BYOCJCPJCCJZBE-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.29 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|