C67H58N2 — CID 118516681
N,N-bis(3,5-dimethylphenyl)-6-[4-(N-(3,5-dimethylphenyl)-3,5-dimethylanilino)-2-methylphenyl]-3,8-diphenylpyren-1-amine (PubChem CID 118516681) has the molecular formula C67H58N2 and a molecular weight of 891.21 g/mol. Its IUPAC name is N,N-bis(3,5-dimethylphenyl)-6-[4-(N-(3,5-dimethylphenyl)-3,5-dimethylanilino)-2-methylphenyl]-3,8-diphenylpyren-1-amine.
| Compound Name | N,N-bis(3,5-dimethylphenyl)-6-[4-(N-(3,5-dimethylphenyl)-3,5-dimethylanilino)-2-methylphenyl]-3,8-diphenylpyren-1-amine |
|---|---|
| PubChem CID | 118516681 |
| Molecular Formula | C67H58N2 |
| Molecular Weight | 891.21 g/mol |
| Exact Mass | 890.46 |
| IUPAC Name | N,N-bis(3,5-dimethylphenyl)-6-[4-(N-(3,5-dimethylphenyl)-3,5-dimethylanilino)-2-methylphenyl]-3,8-diphenylpyren-1-amine |
| SMILES | Cc1cc(C)cc(N(c2cc(C)cc(C)c2)c2ccc(-c3cc(-c4ccccc4)c4ccc5c(N(c6cc(C)cc(C)c6)c6cc(C)cc(C)c6)cc(-c6ccccc6)c6ccc3c4c65)c(C)c2)c1 |
| InChI | InChI=1S/C67H58N2/c1-41-26-42(2)31-53(30-41)68(54-32-43(3)27-44(4)33-54)52-20-21-57(49(9)38-52)64-39-62(50-16-12-10-13-17-50)58-24-25-61-65(40-63(51-18-14-11-15-19-51)59-22-23-60(64)66(58)67(59)61)69(55-34-45(5)28-46(6)35-55)56-36-47(7)29-48(8)37-56/h10-40H,1-9H3 |
| InChIKey | MNMMFHWNQSELON-UHFFFAOYSA-N |
| XLogP | 19.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.21 |
| LogP ≤ 5 | 19.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|