C57H48N2Si — CID 165066954
N-phenyl-N-[4-[4-[4-(N-(4-phenylphenyl)anilino)phenyl]phenyl]phenyl]-3-(4-trimethylsilylphenyl)aniline (PubChem CID 165066954) has the molecular formula C57H48N2Si and a molecular weight of 789.11 g/mol. Its IUPAC name is N-phenyl-N-[4-[4-[4-(N-(4-phenylphenyl)anilino)phenyl]phenyl]phenyl]-3-(4-trimethylsilylphenyl)aniline.
| Compound Name | N-phenyl-N-[4-[4-[4-(N-(4-phenylphenyl)anilino)phenyl]phenyl]phenyl]-3-(4-trimethylsilylphenyl)aniline |
|---|---|
| PubChem CID | 165066954 |
| Molecular Formula | C57H48N2Si |
| Molecular Weight | 789.11 g/mol |
| Exact Mass | 788.36 |
| IUPAC Name | N-phenyl-N-[4-[4-[4-(N-(4-phenylphenyl)anilino)phenyl]phenyl]phenyl]-3-(4-trimethylsilylphenyl)aniline |
| SMILES | C[Si](C)(C)c1ccc(-c2cccc(N(c3ccccc3)c3ccc(-c4ccc(-c5ccc(N(c6ccccc6)c6ccc(-c7ccccc7)cc6)cc5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C57H48N2Si/c1-60(2,3)57-40-32-49(33-41-57)50-16-13-21-56(42-50)59(52-19-11-6-12-20-52)55-38-30-48(31-39-55)45-24-22-44(23-25-45)47-28-36-54(37-29-47)58(51-17-9-5-10-18-51)53-34-26-46(27-35-53)43-14-7-4-8-15-43/h4-42H,1-3H3 |
| InChIKey | AOSGZMBXVPICSJ-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.11 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|