C49H42N2Si — CID 165040481
N-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine (PubChem CID 165040481) has the molecular formula C49H42N2Si and a molecular weight of 686.98 g/mol. Its IUPAC name is N-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine.
| Compound Name | N-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 165040481 |
| Molecular Formula | C49H42N2Si |
| Molecular Weight | 686.98 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | N-[4-[4-[4-(N-phenylanilino)phenyl]phenyl]phenyl]-N-(4-trimethylsilylphenyl)naphthalen-2-amine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)cc2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C49H42N2Si/c1-52(2,3)49-34-32-47(33-35-49)51(48-31-26-37-12-10-11-13-42(37)36-48)46-29-24-41(25-30-46)39-20-18-38(19-21-39)40-22-27-45(28-23-40)50(43-14-6-4-7-15-43)44-16-8-5-9-17-44/h4-36H,1-3H3 |
| InChIKey | CSJABLBFXIVRCU-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.98 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|