C62H54N2Si2 — CID 123737685
N-phenyl-N-(4-trimethylsilylphenyl)-4-[6-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]benzo[e]pyren-3-yl]aniline (PubChem CID 123737685) has the molecular formula C62H54N2Si2 and a molecular weight of 883.30 g/mol. Its IUPAC name is N-phenyl-N-(4-trimethylsilylphenyl)-4-[6-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]benzo[e]pyren-3-yl]aniline.
| Compound Name | N-phenyl-N-(4-trimethylsilylphenyl)-4-[6-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]benzo[e]pyren-3-yl]aniline |
|---|---|
| PubChem CID | 123737685 |
| Molecular Formula | C62H54N2Si2 |
| Molecular Weight | 883.30 g/mol |
| Exact Mass | 882.38 |
| IUPAC Name | N-phenyl-N-(4-trimethylsilylphenyl)-4-[6-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]benzo[e]pyren-3-yl]aniline |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccccc2)c2ccc(-c3ccc4c5ccccc5c5ccc(-c6ccc(N(c7ccccc7)c7ccc([Si](C)(C)C)cc7)cc6)c6ccc3c4c65)cc2)cc1 |
| InChI | InChI=1S/C62H54N2Si2/c1-65(2,3)51-33-29-49(30-34-51)63(45-15-9-7-10-16-45)47-25-21-43(22-26-47)53-37-39-59-55-19-13-14-20-56(55)60-40-38-54(58-42-41-57(53)61(59)62(58)60)44-23-27-48(28-24-44)64(46-17-11-8-12-18-46)50-31-35-52(36-32-50)66(4,5)6/h7-42H,1-6H3 |
| InChIKey | DRHCCWCSXUQBHW-UHFFFAOYSA-N |
| XLogP | 17.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.30 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|